C17H18BrNO2 — CID 42954019
2-[(4-bromophenyl)methyl-methylamino]-2-(4-methylphenyl)acetic acid (PubChem CID 42954019) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-methylamino]-2-(4-methylphenyl)acetic acid.
| Compound Name | 2-[(4-bromophenyl)methyl-methylamino]-2-(4-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 42954019 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-methylamino]-2-(4-methylphenyl)acetic acid |
| SMILES | Cc1ccc(C(C(=O)O)N(C)Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H18BrNO2/c1-12-3-7-14(8-4-12)16(17(20)21)19(2)11-13-5-9-15(18)10-6-13/h3-10,16H,11H2,1-2H3,(H,20,21) |
| InChIKey | JIAKBSVDWVJDQO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |