C15H16ClNO3S — CID 51168884
2-[2-(3-chlorophenoxy)ethylsulfanyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 51168884) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-[2-(3-chlorophenoxy)ethylsulfanyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[2-(3-chlorophenoxy)ethylsulfanyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 51168884 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-[2-(3-chlorophenoxy)ethylsulfanyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CSCCOc1cccc(Cl)c1)NCc1ccco1 |
| InChI | InChI=1S/C15H16ClNO3S/c16-12-3-1-4-13(9-12)20-7-8-21-11-15(18)17-10-14-5-2-6-19-14/h1-6,9H,7-8,10-11H2,(H,17,18) |
| InChIKey | BYRDGEHGCREHNZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|