C15H12N2OS — CID 511722
N-(1,2-benzothiazol-3-yl)-1-(4-methoxyphenyl)methanimine (PubChem CID 511722) has the molecular formula C15H12N2OS and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(1,2-benzothiazol-3-yl)-1-(4-methoxyphenyl)methanimine.
| Compound Name | N-(1,2-benzothiazol-3-yl)-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 511722 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-(1,2-benzothiazol-3-yl)-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/C=N/c2nsc3ccccc23)cc1 |
| InChI | InChI=1S/C15H12N2OS/c1-18-12-8-6-11(7-9-12)10-16-15-13-4-2-3-5-14(13)19-17-15/h2-10H,1H3/b16-10+ |
| InChIKey | GFCULCXZSLYMRD-MHWRWJLKSA-N |
| XLogP | 4.06 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|