C8H6FNOS — CID 130064220
5-fluoro-6-methoxy-1,2-benzothiazole (PubChem CID 130064220) has the molecular formula C8H6FNOS and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-fluoro-6-methoxy-1,2-benzothiazole.
| Compound Name | 5-fluoro-6-methoxy-1,2-benzothiazole |
|---|---|
| PubChem CID | 130064220 |
| Molecular Formula | C8H6FNOS |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 5-fluoro-6-methoxy-1,2-benzothiazole |
| SMILES | COc1cc2sncc2cc1F |
| InChI | InChI=1S/C8H6FNOS/c1-11-7-3-8-5(2-6(7)9)4-10-12-8/h2-4H,1H3 |
| InChIKey | NGNOPJQBFUPJNQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |