C16H14ClN3O2S — CID 51174011
N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-quinazolin-4-yloxyacetamide (PubChem CID 51174011) has the molecular formula C16H14ClN3O2S and a molecular weight of 347.83 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-quinazolin-4-yloxyacetamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-quinazolin-4-yloxyacetamide |
|---|---|
| PubChem CID | 51174011 |
| Molecular Formula | C16H14ClN3O2S |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-quinazolin-4-yloxyacetamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)COc1ncnc2ccccc12 |
| InChI | InChI=1S/C16H14ClN3O2S/c1-20(8-11-6-7-14(17)23-11)15(21)9-22-16-12-4-2-3-5-13(12)18-10-19-16/h2-7,10H,8-9H2,1H3 |
| InChIKey | UCRRQVARGRYUBP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |