C14H12Cl2N2O3S — CID 55357774
[2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 55357774) has the molecular formula C14H12Cl2N2O3S and a molecular weight of 359.23 g/mol. Its IUPAC name is [2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 55357774 |
| Molecular Formula | C14H12Cl2N2O3S |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | [2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)COC(=O)c1cccnc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O3S/c1-18(7-9-4-5-11(15)22-9)12(19)8-21-14(20)10-3-2-6-17-13(10)16/h2-6H,7-8H2,1H3 |
| InChIKey | XGRZLDCJODPQPG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|