C12H13ClN2O5S — CID 55999835
[2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate (PubChem CID 55999835) has the molecular formula C12H13ClN2O5S and a molecular weight of 332.77 g/mol. Its IUPAC name is [2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate.
| Compound Name | [2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 55999835 |
| Molecular Formula | C12H13ClN2O5S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | [2-[(5-chlorothiophen-2-yl)methyl-methylamino]-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)COC(=O)C1CC1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13ClN2O5S/c1-14(5-7-2-3-10(13)21-7)11(16)6-20-12(17)8-4-9(8)15(18)19/h2-3,8-9H,4-6H2,1H3 |
| InChIKey | SYUZNQKPUFDERU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|