C13H19ClN2O2S — CID 55252348
N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-piperidin-4-yloxyacetamide (PubChem CID 55252348) has the molecular formula C13H19ClN2O2S and a molecular weight of 302.83 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-piperidin-4-yloxyacetamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-piperidin-4-yloxyacetamide |
|---|---|
| PubChem CID | 55252348 |
| Molecular Formula | C13H19ClN2O2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-piperidin-4-yloxyacetamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)COC1CCNCC1 |
| InChI | InChI=1S/C13H19ClN2O2S/c1-16(8-11-2-3-12(14)19-11)13(17)9-18-10-4-6-15-7-5-10/h2-3,10,15H,4-9H2,1H3 |
| InChIKey | ZDSHRPCODAFIPG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |