C20H28N2O3 — CID 51176726
4-(2,3-dihydro-1H-inden-5-yl)-N-(3-morpholin-4-ylpropyl)-4-oxobutanamide (PubChem CID 51176726) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yl)-N-(3-morpholin-4-ylpropyl)-4-oxobutanamide.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yl)-N-(3-morpholin-4-ylpropyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 51176726 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yl)-N-(3-morpholin-4-ylpropyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)CCC2)NCCCN1CCOCC1 |
| InChI | InChI=1S/C20H28N2O3/c23-19(18-6-5-16-3-1-4-17(16)15-18)7-8-20(24)21-9-2-10-22-11-13-25-14-12-22/h5-6,15H,1-4,7-14H2,(H,21,24) |
| InChIKey | WGYNJDOCFPKOON-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|