C19H22N2O3 — CID 51180214
N-[4-oxo-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)butyl]furan-2-carboxamide (PubChem CID 51180214) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[4-oxo-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)butyl]furan-2-carboxamide.
| Compound Name | N-[4-oxo-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51180214 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[4-oxo-4-(1,2,3,4-tetrahydronaphthalen-1-ylamino)butyl]furan-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccco1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H22N2O3/c22-18(11-4-12-20-19(23)17-10-5-13-24-17)21-16-9-3-7-14-6-1-2-8-15(14)16/h1-2,5-6,8,10,13,16H,3-4,7,9,11-12H2,(H,20,23)(H,21,22) |
| InChIKey | ZEUXCZAZWXKVNZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|