C23H24N2O4 — CID 51183590
[4-(2-benzoylbenzoyl)piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 51183590) has the molecular formula C23H24N2O4 and a molecular weight of 392.45 g/mol. Its IUPAC name is [4-(2-benzoylbenzoyl)piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(2-benzoylbenzoyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 51183590 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [4-(2-benzoylbenzoyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(c1ccccc1)c1ccccc1C(=O)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C23H24N2O4/c26-21(17-7-2-1-3-8-17)18-9-4-5-10-19(18)22(27)24-12-14-25(15-13-24)23(28)20-11-6-16-29-20/h1-5,7-10,20H,6,11-16H2 |
| InChIKey | GCWOTIKWFMPOOU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |