About 1-pentoxy-3-phenylurea
1-pentoxy-3-phenylurea (PubChem CID 5118367) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-pentoxy-3-phenylurea.
Molecular Properties
| Compound Name | 1-pentoxy-3-phenylurea |
| PubChem CID | 5118367 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-pentoxy-3-phenylurea |
| SMILES | CCCCCONC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-3-7-10-16-14-12(15)13-11-8-5-4-6-9-11/h4-6,8-9H,2-3,7,10H2,1H3,(H2,13,14,15) |
| InChIKey | CQAHLWLGADUHIL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxy-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxy-3-phenylurea?
The IUPAC name of 1-pentoxy-3-phenylurea (CID 5118367) is 1-pentoxy-3-phenylurea.
What is the SMILES notation for 1-pentoxy-3-phenylurea?
The canonical SMILES for 1-pentoxy-3-phenylurea is CCCCCONC(=O)Nc1ccccc1.
What is the InChIKey of 1-pentoxy-3-phenylurea?
The InChIKey is CQAHLWLGADUHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-2-3-7-10-16-14-12(15)13-11-8-5-4-6-9-11/h4-6,8-9H,2-3,7,10H2,1H3,(H2,13,14,15).
What are the key properties of 1-pentoxy-3-phenylurea?
1-pentoxy-3-phenylurea has a molecular weight of 222.29 g/mol, XLogP of 2.93, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxy-3-phenylurea is sourced from PubChem (CID 5118367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).