C29H26N2O8S — CID 5118483
4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 5118483) has the molecular formula C29H26N2O8S and a molecular weight of 562.60 g/mol. Its IUPAC name is 4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5118483 |
| Molecular Formula | C29H26N2O8S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C(O)=C2C(=O)C(=O)N(c3nc4ccc(OC)cc4s3)C2c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C29H26N2O8S/c1-35-17-8-6-7-15(11-17)25(32)23-24(16-12-20(37-3)27(39-5)21(13-16)38-4)31(28(34)26(23)33)29-30-19-10-9-18(36-2)14-22(19)40-29/h6-14,24,32H,1-5H3 |
| InChIKey | BSUXDHOEUVGGHW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|