C30H28N2O8S — CID 98325743
(4E,5S)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 98325743) has the molecular formula C30H28N2O8S and a molecular weight of 576.63 g/mol. Its IUPAC name is (4E,5S)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98325743 |
| Molecular Formula | C30H28N2O8S |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | (4E,5S)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc(OC)c(C)c4)[C@@H]3c3cc(OC)c(OC)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C30H28N2O8S/c1-15-11-16(7-10-20(15)37-3)26(33)24-25(17-12-21(38-4)28(40-6)22(13-17)39-5)32(29(35)27(24)34)30-31-19-9-8-18(36-2)14-23(19)41-30/h7-14,25,33H,1-6H3/b26-24+/t25-/m0/s1 |
| InChIKey | RHGCYTDVJKCSHW-IUKMQXEJSA-N |
| XLogP | 5.27 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|