C14H14FN3O2 — CID 51189967
N-ethyl-N-[(3-fluorophenyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 51189967) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluorophenyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-ethyl-N-[(3-fluorophenyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 51189967 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-ethyl-N-[(3-fluorophenyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C14H14FN3O2/c1-2-18(9-10-4-3-5-11(15)8-10)14(20)12-6-7-13(19)17-16-12/h3-8H,2,9H2,1H3,(H,17,19) |
| InChIKey | CJSWBKUTBCYXMC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |