C17H20FN5OS — CID 51190704
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 51190704) has the molecular formula C17H20FN5OS and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 51190704 |
| Molecular Formula | C17H20FN5OS |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(N)nc(SCC(=O)N2CCN(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C17H20FN5OS/c1-12-10-15(19)21-17(20-12)25-11-16(24)23-8-6-22(7-9-23)14-4-2-13(18)3-5-14/h2-5,10H,6-9,11H2,1H3,(H2,19,20,21) |
| InChIKey | VSUVTRGGVDKCHG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |