C12H18N4O2S — CID 24577928
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(2-methylmorpholin-4-yl)ethanone (PubChem CID 24577928) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(2-methylmorpholin-4-yl)ethanone.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(2-methylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 24577928 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(2-methylmorpholin-4-yl)ethanone |
| SMILES | Cc1cc(N)nc(SCC(=O)N2CCOC(C)C2)n1 |
| InChI | InChI=1S/C12H18N4O2S/c1-8-5-10(13)15-12(14-8)19-7-11(17)16-3-4-18-9(2)6-16/h5,9H,3-4,6-7H2,1-2H3,(H2,13,14,15) |
| InChIKey | USOKZMFMPNKODQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |