C14H22N4OS — CID 40663109
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-[(2R)-2-ethylpiperidin-1-yl]ethanone (PubChem CID 40663109) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-[(2R)-2-ethylpiperidin-1-yl]ethanone.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-[(2R)-2-ethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 40663109 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-[(2R)-2-ethylpiperidin-1-yl]ethanone |
| SMILES | CC[C@@H]1CCCCN1C(=O)CSc1nc(C)cc(N)n1 |
| InChI | InChI=1S/C14H22N4OS/c1-3-11-6-4-5-7-18(11)13(19)9-20-14-16-10(2)8-12(15)17-14/h8,11H,3-7,9H2,1-2H3,(H2,15,16,17)/t11-/m1/s1 |
| InChIKey | PIHRVMQYGCXINJ-LLVKDONJSA-N |
| XLogP | 2.25 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |