C15H18N4OS2 — CID 71939860
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(2-thiophen-3-ylpyrrolidin-1-yl)ethanone (PubChem CID 71939860) has the molecular formula C15H18N4OS2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(2-thiophen-3-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(2-thiophen-3-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 71939860 |
| Molecular Formula | C15H18N4OS2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(2-thiophen-3-ylpyrrolidin-1-yl)ethanone |
| SMILES | Cc1cc(N)nc(SCC(=O)N2CCCC2c2ccsc2)n1 |
| InChI | InChI=1S/C15H18N4OS2/c1-10-7-13(16)18-15(17-10)22-9-14(20)19-5-2-3-12(19)11-4-6-21-8-11/h4,6-8,12H,2-3,5,9H2,1H3,(H2,16,17,18) |
| InChIKey | QXDSZFFCQXSATF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |