C12H17N3O2S — CID 43301826
2-[(6-amino-3-pyridinyl)sulfanyl]-1-(2-methylmorpholin-4-yl)ethanone (PubChem CID 43301826) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-[(6-amino-3-pyridinyl)sulfanyl]-1-(2-methylmorpholin-4-yl)ethanone.
| Compound Name | 2-[(6-amino-3-pyridinyl)sulfanyl]-1-(2-methylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 43301826 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-[(6-amino-3-pyridinyl)sulfanyl]-1-(2-methylmorpholin-4-yl)ethanone |
| SMILES | CC1CN(C(=O)CSc2ccc(N)nc2)CCO1 |
| InChI | InChI=1S/C12H17N3O2S/c1-9-7-15(4-5-17-9)12(16)8-18-10-2-3-11(13)14-6-10/h2-3,6,9H,4-5,7-8H2,1H3,(H2,13,14) |
| InChIKey | HVULGTHWFBSDMN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |