C14H19NO3S — CID 81209125
1-[2-(hydroxymethyl)morpholin-4-yl]-2-(4-methylphenyl)sulfanylethanone (PubChem CID 81209125) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)morpholin-4-yl]-2-(4-methylphenyl)sulfanylethanone.
| Compound Name | 1-[2-(hydroxymethyl)morpholin-4-yl]-2-(4-methylphenyl)sulfanylethanone |
|---|---|
| PubChem CID | 81209125 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-[2-(hydroxymethyl)morpholin-4-yl]-2-(4-methylphenyl)sulfanylethanone |
| SMILES | Cc1ccc(SCC(=O)N2CCOC(CO)C2)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-11-2-4-13(5-3-11)19-10-14(17)15-6-7-18-12(8-15)9-16/h2-5,12,16H,6-10H2,1H3 |
| InChIKey | OSVHIKQOICNMRW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |