About N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide
N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide (PubChem CID 51199440) has the molecular formula C19H20N2O2S
and a molecular weight of 340.45 g/mol. Its IUPAC name is N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide.
Molecular Properties
| Compound Name | N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide |
| PubChem CID | 51199440 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide |
| SMILES | CC(c1ccccc1)N(C)C(=O)CN1C(=O)CSc2ccccc21 |
| InChI | InChI=1S/C19H20N2O2S/c1-14(15-8-4-3-5-9-15)20(2)18(22)12-21-16-10-6-7-11-17(16)24-13-19(21)23/h3-11,14H,12-13H2,1-2H3 |
| InChIKey | WDFBCQWPPXFYMK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide?
The IUPAC name of N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide (CID 51199440) is N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide.
What is the SMILES notation for N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide?
The canonical SMILES for N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide is CC(c1ccccc1)N(C)C(=O)CN1C(=O)CSc2ccccc21.
What is the InChIKey of N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide?
The InChIKey is WDFBCQWPPXFYMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2S/c1-14(15-8-4-3-5-9-15)20(2)18(22)12-21-16-10-6-7-11-17(16)24-13-19(21)23/h3-11,14H,12-13H2,1-2H3.
What are the key properties of N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide?
N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide has a molecular weight of 340.45 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(3-oxo-1,4-benzothiazin-4-yl)-N-(1-phenylethyl)acetamide is sourced from PubChem (CID 51199440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).