C23H27N3O3 — CID 51207767
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide (PubChem CID 51207767) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 51207767 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
| SMILES | CC1CCN(c2ccc(NC(=O)CN3C(=O)C4C5C=CC(C5)C4C3=O)cc2)CC1 |
| InChI | InChI=1S/C23H27N3O3/c1-14-8-10-25(11-9-14)18-6-4-17(5-7-18)24-19(27)13-26-22(28)20-15-2-3-16(12-15)21(20)23(26)29/h2-7,14-16,20-21H,8-13H2,1H3,(H,24,27) |
| InChIKey | BPFXYVOYDIRGLJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|