C15H15BrN2O3 — CID 51209692
2-(5-bromo-2-oxo-1-pyridinyl)-N-(2-phenoxyethyl)acetamide (PubChem CID 51209692) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-(5-bromo-2-oxo-1-pyridinyl)-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-(5-bromo-2-oxo-1-pyridinyl)-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 51209692 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-(5-bromo-2-oxo-1-pyridinyl)-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(Cn1cc(Br)ccc1=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C15H15BrN2O3/c16-12-6-7-15(20)18(10-12)11-14(19)17-8-9-21-13-4-2-1-3-5-13/h1-7,10H,8-9,11H2,(H,17,19) |
| InChIKey | TUHWMWSYZIBGJP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|