C19H23N5O2S — CID 51212842
7a-methyl-3-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one (PubChem CID 51212842) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is 7a-methyl-3-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one.
| Compound Name | 7a-methyl-3-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 51212842 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 7a-methyl-3-[4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-1-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
| SMILES | CC12CCC(=O)N1C(C(=O)N1CCC(c3nnc4ccccn34)CC1)CS2 |
| InChI | InChI=1S/C19H23N5O2S/c1-19-8-5-16(25)24(19)14(12-27-19)18(26)22-10-6-13(7-11-22)17-21-20-15-4-2-3-9-23(15)17/h2-4,9,13-14H,5-8,10-12H2,1H3 |
| InChIKey | RJQMXWONCUZRKE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |