C19H17FN4O4 — CID 51215358
N-ethyl-N-[(3-fluorophenyl)methyl]-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 51215358) has the molecular formula C19H17FN4O4 and a molecular weight of 384.37 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluorophenyl)methyl]-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 51215358 |
| Molecular Formula | C19H17FN4O4 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-ethyl-N-[(3-fluorophenyl)methyl]-2-(6-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)Cn1cnc2ccc([N+](=O)[O-])cc2c1=O |
| InChI | InChI=1S/C19H17FN4O4/c1-2-22(10-13-4-3-5-14(20)8-13)18(25)11-23-12-21-17-7-6-15(24(27)28)9-16(17)19(23)26/h3-9,12H,2,10-11H2,1H3 |
| InChIKey | PAKZHRZVXYGIQF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|