C21H22N2O3S — CID 51223254
1-[4-[2-hydroxy-3-(1-prop-2-enylbenzimidazol-2-yl)sulfanylpropoxy]phenyl]ethanone (PubChem CID 51223254) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-(1-prop-2-enylbenzimidazol-2-yl)sulfanylpropoxy]phenyl]ethanone.
| Compound Name | 1-[4-[2-hydroxy-3-(1-prop-2-enylbenzimidazol-2-yl)sulfanylpropoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 51223254 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-[4-[2-hydroxy-3-(1-prop-2-enylbenzimidazol-2-yl)sulfanylpropoxy]phenyl]ethanone |
| SMILES | C=CCn1c(SCC(O)COc2ccc(C(C)=O)cc2)nc2ccccc21 |
| InChI | InChI=1S/C21H22N2O3S/c1-3-12-23-20-7-5-4-6-19(20)22-21(23)27-14-17(25)13-26-18-10-8-16(9-11-18)15(2)24/h3-11,17,25H,1,12-14H2,2H3 |
| InChIKey | UBQAJBHGWZJWSY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|