C17H14N2O3 — CID 51228371
4-(1,3-benzoxazol-2-ylmethoxy)-3-ethoxybenzonitrile (PubChem CID 51228371) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylmethoxy)-3-ethoxybenzonitrile.
| Compound Name | 4-(1,3-benzoxazol-2-ylmethoxy)-3-ethoxybenzonitrile |
|---|---|
| PubChem CID | 51228371 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylmethoxy)-3-ethoxybenzonitrile |
| SMILES | CCOc1cc(C#N)ccc1OCc1nc2ccccc2o1 |
| InChI | InChI=1S/C17H14N2O3/c1-2-20-16-9-12(10-18)7-8-15(16)21-11-17-19-13-5-3-4-6-14(13)22-17/h3-9H,2,11H2,1H3 |
| InChIKey | YVYIMHVHGADYGN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |