C15H17N3O3S — CID 51228805
2-[(Z)-(1-amino-2-phenoxyethylidene)amino]oxy-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 51228805) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-[(Z)-(1-amino-2-phenoxyethylidene)amino]oxy-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(Z)-(1-amino-2-phenoxyethylidene)amino]oxy-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 51228805 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[(Z)-(1-amino-2-phenoxyethylidene)amino]oxy-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | N/C(COc1ccccc1)=N\OCC(=O)NCc1cccs1 |
| InChI | InChI=1S/C15H17N3O3S/c16-14(10-20-12-5-2-1-3-6-12)18-21-11-15(19)17-9-13-7-4-8-22-13/h1-8H,9-11H2,(H2,16,18)(H,17,19) |
| InChIKey | DBNYKSILTHDEJV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|