C13H15N3O3 — CID 51228906
2-(4-methoxyphenoxy)-N-(1-methylpyrazol-3-yl)acetamide (PubChem CID 51228906) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-(1-methylpyrazol-3-yl)acetamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-(1-methylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 51228906 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-(1-methylpyrazol-3-yl)acetamide |
| SMILES | COc1ccc(OCC(=O)Nc2ccn(C)n2)cc1 |
| InChI | InChI=1S/C13H15N3O3/c1-16-8-7-12(15-16)14-13(17)9-19-11-5-3-10(18-2)4-6-11/h3-8H,9H2,1-2H3,(H,14,15,17) |
| InChIKey | QLSZDJVXBAYPKW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |