C13H14N4O4 — CID 115412123
5-methoxy-2-[(1-methylpyrazol-3-yl)carbamoylamino]benzoic acid (PubChem CID 115412123) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-methoxy-2-[(1-methylpyrazol-3-yl)carbamoylamino]benzoic acid.
| Compound Name | 5-methoxy-2-[(1-methylpyrazol-3-yl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 115412123 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 5-methoxy-2-[(1-methylpyrazol-3-yl)carbamoylamino]benzoic acid |
| SMILES | COc1ccc(NC(=O)Nc2ccn(C)n2)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H14N4O4/c1-17-6-5-11(16-17)15-13(20)14-10-4-3-8(21-2)7-9(10)12(18)19/h3-7H,1-2H3,(H,18,19)(H2,14,15,16,20) |
| InChIKey | BWIDAMWXQOMMEA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |