C13H16ClN5OS — CID 51245310
N-(4-chlorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylpropanamide (PubChem CID 51245310) has the molecular formula C13H16ClN5OS and a molecular weight of 325.83 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | N-(4-chlorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 51245310 |
| Molecular Formula | C13H16ClN5OS |
| Molecular Weight | 325.83 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1C(C)C)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClN5OS/c1-8(2)19-13(16-17-18-19)21-9(3)12(20)15-11-6-4-10(14)5-7-11/h4-9H,1-3H3,(H,15,20) |
| InChIKey | JHTKROIVBZYTEH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |