C15H14N4OS — CID 51247935
(E)-3-thiophen-2-yl-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]prop-2-enamide (PubChem CID 51247935) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-thiophen-2-yl-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 51247935 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (E)-3-thiophen-2-yl-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1cccs1)c1nnc2ccccn12 |
| InChI | InChI=1S/C15H14N4OS/c1-11(15-18-17-13-6-2-3-9-19(13)15)16-14(20)8-7-12-5-4-10-21-12/h2-11H,1H3,(H,16,20)/b8-7+ |
| InChIKey | ISPIVXLTKGDWTA-BQYQJAHWSA-N |
| XLogP | 2.68 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|