C18H18N4O — CID 51247809
(E)-3-(4-methylphenyl)-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]prop-2-enamide (PubChem CID 51247809) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is (E)-3-(4-methylphenyl)-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methylphenyl)-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 51247809 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (E)-3-(4-methylphenyl)-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC(C)c2nnc3ccccn23)cc1 |
| InChI | InChI=1S/C18H18N4O/c1-13-6-8-15(9-7-13)10-11-17(23)19-14(2)18-21-20-16-5-3-4-12-22(16)18/h3-12,14H,1-2H3,(H,19,23)/b11-10+ |
| InChIKey | BGVZZPOKCWUYMG-ZHACJKMWSA-N |
| XLogP | 2.93 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|