C19H19FN4O — CID 23474073
(E)-3-(4-fluorophenyl)-N-[(1S)-2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]prop-2-enamide (PubChem CID 23474073) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[(1S)-2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[(1S)-2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 23474073 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[(1S)-2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]prop-2-enamide |
| SMILES | CC(C)[C@H](NC(=O)/C=C/c1ccc(F)cc1)c1nnc2ccccn12 |
| InChI | InChI=1S/C19H19FN4O/c1-13(2)18(19-23-22-16-5-3-4-12-24(16)19)21-17(25)11-8-14-6-9-15(20)10-7-14/h3-13,18H,1-2H3,(H,21,25)/b11-8+/t18-/m0/s1 |
| InChIKey | RDOVJESIHRXIIH-MZEUMTGBSA-N |
| XLogP | 3.40 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|