C22H27N5O3S — CID 86876214
(E)-3-[4-(propan-2-ylsulfamoyl)phenyl]-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]prop-2-enamide (PubChem CID 86876214) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is (E)-3-[4-(propan-2-ylsulfamoyl)phenyl]-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(propan-2-ylsulfamoyl)phenyl]-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 86876214 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (E)-3-[4-(propan-2-ylsulfamoyl)phenyl]-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]prop-2-enamide |
| SMILES | CCCC(NC(=O)/C=C/c1ccc(S(=O)(=O)NC(C)C)cc1)c1nnc2ccccn12 |
| InChI | InChI=1S/C22H27N5O3S/c1-4-7-19(22-25-24-20-8-5-6-15-27(20)22)23-21(28)14-11-17-9-12-18(13-10-17)31(29,30)26-16(2)3/h5-6,8-16,19,26H,4,7H2,1-3H3,(H,23,28)/b14-11+ |
| InChIKey | WMDBOTDTZFXOPP-SDNWHVSQSA-N |
| XLogP | 3.09 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|