C18H18ClN3O3 — CID 5125262
2-[[(2-chlorobenzoyl)-prop-2-enylamino]methyl]-N-prop-2-enyl-1,3-oxazole-4-carboxamide (PubChem CID 5125262) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is 2-[[(2-chlorobenzoyl)-prop-2-enylamino]methyl]-N-prop-2-enyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[(2-chlorobenzoyl)-prop-2-enylamino]methyl]-N-prop-2-enyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 5125262 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-[[(2-chlorobenzoyl)-prop-2-enylamino]methyl]-N-prop-2-enyl-1,3-oxazole-4-carboxamide |
| SMILES | C=CCNC(=O)c1coc(CN(CC=C)C(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C18H18ClN3O3/c1-3-9-20-17(23)15-12-25-16(21-15)11-22(10-4-2)18(24)13-7-5-6-8-14(13)19/h3-8,12H,1-2,9-11H2,(H,20,23) |
| InChIKey | WHAMUIBBKDYDOH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|