C16H17ClN4O5 — CID 1195801
2-[[(2-chloro-4-nitrobenzoyl)-ethylamino]methyl]-N-ethyl-1,3-oxazole-4-carboxamide (PubChem CID 1195801) has the molecular formula C16H17ClN4O5 and a molecular weight of 380.79 g/mol. Its IUPAC name is 2-[[(2-chloro-4-nitrobenzoyl)-ethylamino]methyl]-N-ethyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[(2-chloro-4-nitrobenzoyl)-ethylamino]methyl]-N-ethyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 1195801 |
| Molecular Formula | C16H17ClN4O5 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-[[(2-chloro-4-nitrobenzoyl)-ethylamino]methyl]-N-ethyl-1,3-oxazole-4-carboxamide |
| SMILES | CCNC(=O)c1coc(CN(CC)C(=O)c2ccc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C16H17ClN4O5/c1-3-18-15(22)13-9-26-14(19-13)8-20(4-2)16(23)11-6-5-10(21(24)25)7-12(11)17/h5-7,9H,3-4,8H2,1-2H3,(H,18,22) |
| InChIKey | WNPOJCKJLADKRJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|