C16H14ClN3O6 — CID 4319931
methyl 2-[[(2-chloro-4-nitrobenzoyl)-cyclopropylamino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 4319931) has the molecular formula C16H14ClN3O6 and a molecular weight of 379.76 g/mol. Its IUPAC name is methyl 2-[[(2-chloro-4-nitrobenzoyl)-cyclopropylamino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(2-chloro-4-nitrobenzoyl)-cyclopropylamino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 4319931 |
| Molecular Formula | C16H14ClN3O6 |
| Molecular Weight | 379.76 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | methyl 2-[[(2-chloro-4-nitrobenzoyl)-cyclopropylamino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(CN(C(=O)c2ccc([N+](=O)[O-])cc2Cl)C2CC2)n1 |
| InChI | InChI=1S/C16H14ClN3O6/c1-25-16(22)13-8-26-14(18-13)7-19(9-2-3-9)15(21)11-5-4-10(20(23)24)6-12(11)17/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | BBWNORLXACXOAI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 115.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|