C19H18ClN3O2S — CID 51254845
N-[(5-chlorothiophen-2-yl)methyl]-3-(4-oxocinnolin-1-yl)-N-prop-2-enylpropanamide (PubChem CID 51254845) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-3-(4-oxocinnolin-1-yl)-N-prop-2-enylpropanamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-3-(4-oxocinnolin-1-yl)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 51254845 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-3-(4-oxocinnolin-1-yl)-N-prop-2-enylpropanamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)CCn1ncc(=O)c2ccccc21 |
| InChI | InChI=1S/C19H18ClN3O2S/c1-2-10-22(13-14-7-8-18(20)26-14)19(25)9-11-23-16-6-4-3-5-15(16)17(24)12-21-23/h2-8,12H,1,9-11,13H2 |
| InChIKey | VBVCYTPAIYVYAL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|