C20H23F2N3O3 — CID 51255380
N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-2-(propan-2-ylcarbamoylamino)benzamide (PubChem CID 51255380) has the molecular formula C20H23F2N3O3 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-2-(propan-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-2-(propan-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 51255380 |
| Molecular Formula | C20H23F2N3O3 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-2-(propan-2-ylcarbamoylamino)benzamide |
| SMILES | CC(C)NC(=O)Nc1ccccc1C(=O)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H23F2N3O3/c1-13(2)23-20(27)24-17-7-5-4-6-16(17)18(26)25(3)12-14-8-10-15(11-9-14)28-19(21)22/h4-11,13,19H,12H2,1-3H3,(H2,23,24,27) |
| InChIKey | JTKARBKNKXPCKM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |