C20H15F3N6O — CID 5125639
3-methyl-6-pyridin-4-yl-1-[2-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 5125639) has the molecular formula C20H15F3N6O and a molecular weight of 412.38 g/mol. Its IUPAC name is 3-methyl-6-pyridin-4-yl-1-[2-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | 3-methyl-6-pyridin-4-yl-1-[2-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 5125639 |
| Molecular Formula | C20H15F3N6O |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 3-methyl-6-pyridin-4-yl-1-[2-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | Cc1nn(-c2ccccc2C(F)(F)F)c2nc(-c3ccncc3)cc(C(=O)NN)c12 |
| InChI | InChI=1S/C20H15F3N6O/c1-11-17-13(19(30)27-24)10-15(12-6-8-25-9-7-12)26-18(17)29(28-11)16-5-3-2-4-14(16)20(21,22)23/h2-10H,24H2,1H3,(H,27,30) |
| InChIKey | SSLGMANPTFNZET-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|