C28H21F3N6O — CID 2423029
3-methyl-N-[(3-methylphenyl)methylideneamino]-6-pyridin-4-yl-1-[2-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 2423029) has the molecular formula C28H21F3N6O and a molecular weight of 514.51 g/mol. Its IUPAC name is 3-methyl-N-[(3-methylphenyl)methylideneamino]-6-pyridin-4-yl-1-[2-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 3-methyl-N-[(3-methylphenyl)methylideneamino]-6-pyridin-4-yl-1-[2-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 2423029 |
| Molecular Formula | C28H21F3N6O |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 3-methyl-N-[(3-methylphenyl)methylideneamino]-6-pyridin-4-yl-1-[2-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cccc(C=NNC(=O)c2cc(-c3ccncc3)nc3c2c(C)nn3-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C28H21F3N6O/c1-17-6-5-7-19(14-17)16-33-35-27(38)21-15-23(20-10-12-32-13-11-20)34-26-25(21)18(2)36-37(26)24-9-4-3-8-22(24)28(29,30)31/h3-16H,1-2H3,(H,35,38) |
| InChIKey | ZWLICDZPMKHHLD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|