C15H22N6O2 — CID 51261369
N-(3-methoxypropyl)-2-[methyl-[(1-phenyltetrazol-5-yl)methyl]amino]acetamide (PubChem CID 51261369) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[methyl-[(1-phenyltetrazol-5-yl)methyl]amino]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[methyl-[(1-phenyltetrazol-5-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 51261369 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N-(3-methoxypropyl)-2-[methyl-[(1-phenyltetrazol-5-yl)methyl]amino]acetamide |
| SMILES | COCCCNC(=O)CN(C)Cc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C15H22N6O2/c1-20(12-15(22)16-9-6-10-23-2)11-14-17-18-19-21(14)13-7-4-3-5-8-13/h3-5,7-8H,6,9-12H2,1-2H3,(H,16,22) |
| InChIKey | HFJFPPGPFHNQRK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|