C26H27N5O2S — CID 55556542
N-[3-(1-phenylethoxy)propyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide (PubChem CID 55556542) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[3-(1-phenylethoxy)propyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide.
| Compound Name | N-[3-(1-phenylethoxy)propyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 55556542 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[3-(1-phenylethoxy)propyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
| SMILES | CC(OCCCNC(=O)c1ccccc1SCc1nnnn1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27N5O2S/c1-20(21-11-4-2-5-12-21)33-18-10-17-27-26(32)23-15-8-9-16-24(23)34-19-25-28-29-30-31(25)22-13-6-3-7-14-22/h2-9,11-16,20H,10,17-19H2,1H3,(H,27,32) |
| InChIKey | QOLJCLXLJJGNOE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|