C24H19N5OS2 — CID 55964665
N-(1-benzothiophen-3-ylmethyl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide (PubChem CID 55964665) has the molecular formula C24H19N5OS2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 55964665 |
| Molecular Formula | C24H19N5OS2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
| SMILES | O=C(NCc1csc2ccccc12)c1ccccc1SCc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C24H19N5OS2/c30-24(25-14-17-15-31-21-12-6-4-10-19(17)21)20-11-5-7-13-22(20)32-16-23-26-27-28-29(23)18-8-2-1-3-9-18/h1-13,15H,14,16H2,(H,25,30) |
| InChIKey | PAQWDGRSGFKTKJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |