C27H19N5O2S — CID 55967239
N-dibenzofuran-3-yl-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide (PubChem CID 55967239) has the molecular formula C27H19N5O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide.
| Compound Name | N-dibenzofuran-3-yl-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 55967239 |
| Molecular Formula | C27H19N5O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-dibenzofuran-3-yl-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)oc1ccccc12)c1ccccc1SCc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C27H19N5O2S/c33-27(28-18-14-15-21-20-10-4-6-12-23(20)34-24(21)16-18)22-11-5-7-13-25(22)35-17-26-29-30-31-32(26)19-8-2-1-3-9-19/h1-16H,17H2,(H,28,33) |
| InChIKey | MRGHSPGQECOVRP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |