C22H19N7O2S — CID 55523727
N-[4-(carbamoylamino)phenyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide (PubChem CID 55523727) has the molecular formula C22H19N7O2S and a molecular weight of 445.51 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 55523727 |
| Molecular Formula | C22H19N7O2S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]benzamide |
| SMILES | NC(=O)Nc1ccc(NC(=O)c2ccccc2SCc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N7O2S/c23-22(31)25-16-12-10-15(11-13-16)24-21(30)18-8-4-5-9-19(18)32-14-20-26-27-28-29(20)17-6-2-1-3-7-17/h1-13H,14H2,(H,24,30)(H3,23,25,31) |
| InChIKey | GGDFCUIRPREYGC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |