C22H24N2O2S2 — CID 46550057
N-[3-(1-phenylethoxy)propyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide (PubChem CID 46550057) has the molecular formula C22H24N2O2S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[3-(1-phenylethoxy)propyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide.
| Compound Name | N-[3-(1-phenylethoxy)propyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 46550057 |
| Molecular Formula | C22H24N2O2S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[3-(1-phenylethoxy)propyl]-2-(1,3-thiazol-4-ylmethylsulfanyl)benzamide |
| SMILES | CC(OCCCNC(=O)c1ccccc1SCc1cscn1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2S2/c1-17(18-8-3-2-4-9-18)26-13-7-12-23-22(25)20-10-5-6-11-21(20)28-15-19-14-27-16-24-19/h2-6,8-11,14,16-17H,7,12-13,15H2,1H3,(H,23,25) |
| InChIKey | HBHBVNKNSYHDCL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|