C18H20F2N4OS — CID 51261752
N-(1-cyanocyclohexyl)-2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-methylacetamide (PubChem CID 51261752) has the molecular formula C18H20F2N4OS and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-methylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 51261752 |
| Molecular Formula | C18H20F2N4OS |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-methylacetamide |
| SMILES | CN(C(=O)CSc1nc2ccccc2n1C(F)F)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C18H20F2N4OS/c1-23(18(12-21)9-5-2-6-10-18)15(25)11-26-17-22-13-7-3-4-8-14(13)24(17)16(19)20/h3-4,7-8,16H,2,5-6,9-11H2,1H3 |
| InChIKey | BWFBGNSKKBWNII-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |